C19H24FNO2 — CID 134584699
methyl 4-[(1-adamantylamino)methyl]-3-fluorobenzoate (PubChem CID 134584699) has the molecular formula C19H24FNO2 and a molecular weight of 317.40 g/mol. Its IUPAC name is methyl 4-[(1-adamantylamino)methyl]-3-fluorobenzoate.
| Compound Name | methyl 4-[(1-adamantylamino)methyl]-3-fluorobenzoate |
|---|---|
| PubChem CID | 134584699 |
| Molecular Formula | C19H24FNO2 |
| Molecular Weight | 317.40 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | methyl 4-[(1-adamantylamino)methyl]-3-fluorobenzoate |
| SMILES | COC(=O)c1ccc(CNC23CC4CC(CC(C4)C2)C3)c(F)c1 |
| InChI | InChI=1S/C19H24FNO2/c1-23-18(22)15-2-3-16(17(20)7-15)11-21-19-8-12-4-13(9-19)6-14(5-12)10-19/h2-3,7,12-14,21H,4-6,8-11H2,1H3 |
| InChIKey | UIVCNEZFYACACN-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.40 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |