C21H27ClO2 — CID 148952862
methyl 4-[3-(1-adamantyl)propyl]-3-chlorobenzoate (PubChem CID 148952862) has the molecular formula C21H27ClO2 and a molecular weight of 346.90 g/mol. Its IUPAC name is methyl 4-[3-(1-adamantyl)propyl]-3-chlorobenzoate.
| Compound Name | methyl 4-[3-(1-adamantyl)propyl]-3-chlorobenzoate |
|---|---|
| PubChem CID | 148952862 |
| Molecular Formula | C21H27ClO2 |
| Molecular Weight | 346.90 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | methyl 4-[3-(1-adamantyl)propyl]-3-chlorobenzoate |
| SMILES | COC(=O)c1ccc(CCCC23CC4CC(CC(C4)C2)C3)c(Cl)c1 |
| InChI | InChI=1S/C21H27ClO2/c1-24-20(23)18-5-4-17(19(22)10-18)3-2-6-21-11-14-7-15(12-21)9-16(8-14)13-21/h4-5,10,14-16H,2-3,6-9,11-13H2,1H3 |
| InChIKey | PQHBXYMWTSTELU-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.90 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |