C21H28FNO2 — CID 153453882
methyl 4-[[1-adamantylmethyl(methyl)amino]methyl]-3-(18F)fluorobenzoate (PubChem CID 153453882) has the molecular formula C21H28FNO2 and a molecular weight of 344.46 g/mol. Its IUPAC name is methyl 4-[[1-adamantylmethyl(methyl)amino]methyl]-3-(18F)fluorobenzoate.
| Compound Name | methyl 4-[[1-adamantylmethyl(methyl)amino]methyl]-3-(18F)fluorobenzoate |
|---|---|
| PubChem CID | 153453882 |
| Molecular Formula | C21H28FNO2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | methyl 4-[[1-adamantylmethyl(methyl)amino]methyl]-3-(18F)fluorobenzoate |
| SMILES | COC(=O)c1ccc(CN(C)CC23CC4CC(CC(C4)C2)C3)c([18F])c1 |
| InChI | InChI=1S/C21H28FNO2/c1-23(12-18-4-3-17(8-19(18)22)20(24)25-2)13-21-9-14-5-15(10-21)7-16(6-14)11-21/h3-4,8,14-16H,5-7,9-13H2,1-2H3/i22-1 |
| InChIKey | WHBZBQCDMWWAPQ-KVTPGWOSSA-N |
| XLogP | 4.26 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |