C20H26BrNO2 — CID 146371286
methyl 4-[(1-adamantylmethylamino)methyl]-3-bromobenzoate (PubChem CID 146371286) has the molecular formula C20H26BrNO2 and a molecular weight of 392.34 g/mol. Its IUPAC name is methyl 4-[(1-adamantylmethylamino)methyl]-3-bromobenzoate.
| Compound Name | methyl 4-[(1-adamantylmethylamino)methyl]-3-bromobenzoate |
|---|---|
| PubChem CID | 146371286 |
| Molecular Formula | C20H26BrNO2 |
| Molecular Weight | 392.34 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | methyl 4-[(1-adamantylmethylamino)methyl]-3-bromobenzoate |
| SMILES | COC(=O)c1ccc(CNCC23CC4CC(CC(C4)C2)C3)c(Br)c1 |
| InChI | InChI=1S/C20H26BrNO2/c1-24-19(23)16-2-3-17(18(21)7-16)11-22-12-20-8-13-4-14(9-20)6-15(5-13)10-20/h2-3,7,13-15,22H,4-6,8-12H2,1H3 |
| InChIKey | QYKATUVOMDZUNE-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.34 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |