methyl 3-bromo-4-[(2,2-dicyclopropylethylamino)methyl]benzoate

C17H22BrNO2 — CID 102766729

IUPACmethyl 3-bromo-4-[(2,2-dicyclopropylethylamino)methyl]benzoate
SMILESCOC(=O)c1ccc(CNCC(C2CC2)C2CC2)c(Br)c1
InChIInChI=1S/C17H22BrNO2/c1-21-17(20)13-6-7-14(16(18)8-13)9-19-10-15(11-2-3-11)12-4-5-12/h6-8,11-12,15,19H,2-5,9-10H2,1H3
InChIKeyCQSBQEMRUVNULD-UHFFFAOYSA-N
MW352.27 g/mol
LogP3.76
Rot. Bonds7

About methyl 3-bromo-4-[(2,2-dicyclopropylethylamino)methyl]benzoate

methyl 3-bromo-4-[(2,2-dicyclopropylethylamino)methyl]benzoate (PubChem CID 102766729) has the molecular formula C17H22BrNO2 and a molecular weight of 352.27 g/mol. Its IUPAC name is methyl 3-bromo-4-[(2,2-dicyclopropylethylamino)methyl]benzoate.

Molecular Properties

Compound Namemethyl 3-bromo-4-[(2,2-dicyclopropylethylamino)methyl]benzoate
PubChem CID102766729
Molecular FormulaC17H22BrNO2
Molecular Weight352.27 g/mol
Exact Mass351.08
IUPAC Namemethyl 3-bromo-4-[(2,2-dicyclopropylethylamino)methyl]benzoate
SMILESCOC(=O)c1ccc(CNCC(C2CC2)C2CC2)c(Br)c1
InChIInChI=1S/C17H22BrNO2/c1-21-17(20)13-6-7-14(16(18)8-13)9-19-10-15(11-2-3-11)12-4-5-12/h6-8,11-12,15,19H,2-5,9-10H2,1H3
InChIKeyCQSBQEMRUVNULD-UHFFFAOYSA-N
XLogP3.76
TPSA38.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500352.27
LogP ≤ 53.76
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl 3-bromo-4-[(2,2-dicyclopropylethylamino)methyl]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-bromo-4-[(2,2-dicyclopropylethylamino)methyl]benzoate?
The IUPAC name of methyl 3-bromo-4-[(2,2-dicyclopropylethylamino)methyl]benzoate (CID 102766729) is methyl 3-bromo-4-[(2,2-dicyclopropylethylamino)methyl]benzoate.
What is the SMILES notation for methyl 3-bromo-4-[(2,2-dicyclopropylethylamino)methyl]benzoate?
The canonical SMILES for methyl 3-bromo-4-[(2,2-dicyclopropylethylamino)methyl]benzoate is COC(=O)c1ccc(CNCC(C2CC2)C2CC2)c(Br)c1.
What is the InChIKey of methyl 3-bromo-4-[(2,2-dicyclopropylethylamino)methyl]benzoate?
The InChIKey is CQSBQEMRUVNULD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22BrNO2/c1-21-17(20)13-6-7-14(16(18)8-13)9-19-10-15(11-2-3-11)12-4-5-12/h6-8,11-12,15,19H,2-5,9-10H2,1H3.
What are the key properties of methyl 3-bromo-4-[(2,2-dicyclopropylethylamino)methyl]benzoate?
methyl 3-bromo-4-[(2,2-dicyclopropylethylamino)methyl]benzoate has a molecular weight of 352.27 g/mol, XLogP of 3.76, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-bromo-4-[(2,2-dicyclopropylethylamino)methyl]benzoate is sourced from PubChem (CID 102766729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).