C13H18BrNO3 — CID 102766879
methyl 3-bromo-4-[(2-hydroxybutylamino)methyl]benzoate (PubChem CID 102766879) has the molecular formula C13H18BrNO3 and a molecular weight of 316.20 g/mol. Its IUPAC name is methyl 3-bromo-4-[(2-hydroxybutylamino)methyl]benzoate.
| Compound Name | methyl 3-bromo-4-[(2-hydroxybutylamino)methyl]benzoate |
|---|---|
| PubChem CID | 102766879 |
| Molecular Formula | C13H18BrNO3 |
| Molecular Weight | 316.20 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | methyl 3-bromo-4-[(2-hydroxybutylamino)methyl]benzoate |
| SMILES | CCC(O)CNCc1ccc(C(=O)OC)cc1Br |
| InChI | InChI=1S/C13H18BrNO3/c1-3-11(16)8-15-7-10-5-4-9(6-12(10)14)13(17)18-2/h4-6,11,15-16H,3,7-8H2,1-2H3 |
| InChIKey | DYACCAFVXMGRSE-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.20 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |