C14H19BrN2O3 — CID 102766837
methyl 3-bromo-4-[[[3-(ethylamino)-3-oxopropyl]amino]methyl]benzoate (PubChem CID 102766837) has the molecular formula C14H19BrN2O3 and a molecular weight of 343.22 g/mol. Its IUPAC name is methyl 3-bromo-4-[[[3-(ethylamino)-3-oxopropyl]amino]methyl]benzoate.
| Compound Name | methyl 3-bromo-4-[[[3-(ethylamino)-3-oxopropyl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 102766837 |
| Molecular Formula | C14H19BrN2O3 |
| Molecular Weight | 343.22 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | methyl 3-bromo-4-[[[3-(ethylamino)-3-oxopropyl]amino]methyl]benzoate |
| SMILES | CCNC(=O)CCNCc1ccc(C(=O)OC)cc1Br |
| InChI | InChI=1S/C14H19BrN2O3/c1-3-17-13(18)6-7-16-9-11-5-4-10(8-12(11)15)14(19)20-2/h4-5,8,16H,3,6-7,9H2,1-2H3,(H,17,18) |
| InChIKey | BVXVWMJMLMRCDT-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.22 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|