C16H20BrNO2 — CID 106174082
methyl 3-bromo-4-[[2-(cyclopenten-1-yl)ethylamino]methyl]benzoate (PubChem CID 106174082) has the molecular formula C16H20BrNO2 and a molecular weight of 338.25 g/mol. Its IUPAC name is methyl 3-bromo-4-[[2-(cyclopenten-1-yl)ethylamino]methyl]benzoate.
| Compound Name | methyl 3-bromo-4-[[2-(cyclopenten-1-yl)ethylamino]methyl]benzoate |
|---|---|
| PubChem CID | 106174082 |
| Molecular Formula | C16H20BrNO2 |
| Molecular Weight | 338.25 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | methyl 3-bromo-4-[[2-(cyclopenten-1-yl)ethylamino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CNCCC2=CCCC2)c(Br)c1 |
| InChI | InChI=1S/C16H20BrNO2/c1-20-16(19)13-6-7-14(15(17)10-13)11-18-9-8-12-4-2-3-5-12/h4,6-7,10,18H,2-3,5,8-9,11H2,1H3 |
| InChIKey | CFZAJDDACZGFMR-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.25 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|