C15H16BrNO3 — CID 102766549
methyl 3-bromo-4-[[2-(furan-2-yl)ethylamino]methyl]benzoate (PubChem CID 102766549) has the molecular formula C15H16BrNO3 and a molecular weight of 338.20 g/mol. Its IUPAC name is methyl 3-bromo-4-[[2-(furan-2-yl)ethylamino]methyl]benzoate.
| Compound Name | methyl 3-bromo-4-[[2-(furan-2-yl)ethylamino]methyl]benzoate |
|---|---|
| PubChem CID | 102766549 |
| Molecular Formula | C15H16BrNO3 |
| Molecular Weight | 338.20 g/mol |
| Exact Mass | 337.03 |
| IUPAC Name | methyl 3-bromo-4-[[2-(furan-2-yl)ethylamino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CNCCc2ccco2)c(Br)c1 |
| InChI | InChI=1S/C15H16BrNO3/c1-19-15(18)11-4-5-12(14(16)9-11)10-17-7-6-13-3-2-8-20-13/h2-5,8-9,17H,6-7,10H2,1H3 |
| InChIKey | AFADPHXPXFFLDA-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.20 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|