C13H18BrNO3 — CID 102766529
methyl 3-bromo-4-[(2-ethoxyethylamino)methyl]benzoate (PubChem CID 102766529) has the molecular formula C13H18BrNO3 and a molecular weight of 316.20 g/mol. Its IUPAC name is methyl 3-bromo-4-[(2-ethoxyethylamino)methyl]benzoate.
| Compound Name | methyl 3-bromo-4-[(2-ethoxyethylamino)methyl]benzoate |
|---|---|
| PubChem CID | 102766529 |
| Molecular Formula | C13H18BrNO3 |
| Molecular Weight | 316.20 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | methyl 3-bromo-4-[(2-ethoxyethylamino)methyl]benzoate |
| SMILES | CCOCCNCc1ccc(C(=O)OC)cc1Br |
| InChI | InChI=1S/C13H18BrNO3/c1-3-18-7-6-15-9-11-5-4-10(8-12(11)14)13(16)17-2/h4-5,8,15H,3,6-7,9H2,1-2H3 |
| InChIKey | AQIBSFNXHMZXMX-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.20 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|