C15H21BrN2O2S — CID 106325557
methyl 3-bromo-4-[(2-thiomorpholin-4-ylethylamino)methyl]benzoate (PubChem CID 106325557) has the molecular formula C15H21BrN2O2S and a molecular weight of 373.32 g/mol. Its IUPAC name is methyl 3-bromo-4-[(2-thiomorpholin-4-ylethylamino)methyl]benzoate.
| Compound Name | methyl 3-bromo-4-[(2-thiomorpholin-4-ylethylamino)methyl]benzoate |
|---|---|
| PubChem CID | 106325557 |
| Molecular Formula | C15H21BrN2O2S |
| Molecular Weight | 373.32 g/mol |
| Exact Mass | 372.05 |
| IUPAC Name | methyl 3-bromo-4-[(2-thiomorpholin-4-ylethylamino)methyl]benzoate |
| SMILES | COC(=O)c1ccc(CNCCN2CCSCC2)c(Br)c1 |
| InChI | InChI=1S/C15H21BrN2O2S/c1-20-15(19)12-2-3-13(14(16)10-12)11-17-4-5-18-6-8-21-9-7-18/h2-3,10,17H,4-9,11H2,1H3 |
| InChIKey | JEPKISUXWOBOLI-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.32 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|