C14H19BrN2O2S — CID 106325988
3-bromo-4-[(2-thiomorpholin-4-ylethylamino)methyl]benzoic acid (PubChem CID 106325988) has the molecular formula C14H19BrN2O2S and a molecular weight of 359.29 g/mol. Its IUPAC name is 3-bromo-4-[(2-thiomorpholin-4-ylethylamino)methyl]benzoic acid.
| Compound Name | 3-bromo-4-[(2-thiomorpholin-4-ylethylamino)methyl]benzoic acid |
|---|---|
| PubChem CID | 106325988 |
| Molecular Formula | C14H19BrN2O2S |
| Molecular Weight | 359.29 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | 3-bromo-4-[(2-thiomorpholin-4-ylethylamino)methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CNCCN2CCSCC2)c(Br)c1 |
| InChI | InChI=1S/C14H19BrN2O2S/c15-13-9-11(14(18)19)1-2-12(13)10-16-3-4-17-5-7-20-8-6-17/h1-2,9,16H,3-8,10H2,(H,18,19) |
| InChIKey | ODWZERZWDOVSAI-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.29 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|