C12H14BrNO2 — CID 103268187
3-bromo-4-[(2-methylprop-2-enylamino)methyl]benzoic acid (PubChem CID 103268187) has the molecular formula C12H14BrNO2 and a molecular weight of 284.15 g/mol. Its IUPAC name is 3-bromo-4-[(2-methylprop-2-enylamino)methyl]benzoic acid.
| Compound Name | 3-bromo-4-[(2-methylprop-2-enylamino)methyl]benzoic acid |
|---|---|
| PubChem CID | 103268187 |
| Molecular Formula | C12H14BrNO2 |
| Molecular Weight | 284.15 g/mol |
| Exact Mass | 283.02 |
| IUPAC Name | 3-bromo-4-[(2-methylprop-2-enylamino)methyl]benzoic acid |
| SMILES | C=C(C)CNCc1ccc(C(=O)O)cc1Br |
| InChI | InChI=1S/C12H14BrNO2/c1-8(2)6-14-7-10-4-3-9(12(15)16)5-11(10)13/h3-5,14H,1,6-7H2,2H3,(H,15,16) |
| InChIKey | UTUFHFBHHTWNFI-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.15 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|