C15H14BrNO3 — CID 103268484
3-bromo-4-[[(4-hydroxyphenyl)methylamino]methyl]benzoic acid (PubChem CID 103268484) has the molecular formula C15H14BrNO3 and a molecular weight of 336.19 g/mol. Its IUPAC name is 3-bromo-4-[[(4-hydroxyphenyl)methylamino]methyl]benzoic acid.
| Compound Name | 3-bromo-4-[[(4-hydroxyphenyl)methylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 103268484 |
| Molecular Formula | C15H14BrNO3 |
| Molecular Weight | 336.19 g/mol |
| Exact Mass | 335.02 |
| IUPAC Name | 3-bromo-4-[[(4-hydroxyphenyl)methylamino]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CNCc2ccc(O)cc2)c(Br)c1 |
| InChI | InChI=1S/C15H14BrNO3/c16-14-7-11(15(19)20)3-4-12(14)9-17-8-10-1-5-13(18)6-2-10/h1-7,17-18H,8-9H2,(H,19,20) |
| InChIKey | GLKGDFCOCREJIR-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.19 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |