C16H18BrNO3 — CID 103246842
3-bromo-4-[[4-(furan-2-yl)butan-2-ylamino]methyl]benzoic acid (PubChem CID 103246842) has the molecular formula C16H18BrNO3 and a molecular weight of 352.23 g/mol. Its IUPAC name is 3-bromo-4-[[4-(furan-2-yl)butan-2-ylamino]methyl]benzoic acid.
| Compound Name | 3-bromo-4-[[4-(furan-2-yl)butan-2-ylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 103246842 |
| Molecular Formula | C16H18BrNO3 |
| Molecular Weight | 352.23 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | 3-bromo-4-[[4-(furan-2-yl)butan-2-ylamino]methyl]benzoic acid |
| SMILES | CC(CCc1ccco1)NCc1ccc(C(=O)O)cc1Br |
| InChI | InChI=1S/C16H18BrNO3/c1-11(4-7-14-3-2-8-21-14)18-10-13-6-5-12(16(19)20)9-15(13)17/h2-3,5-6,8-9,11,18H,4,7,10H2,1H3,(H,19,20) |
| InChIKey | WCSNIEPQHJNVNN-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.23 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |