C40H53BrF2N2O4 — CID 160859198
1-adamantylmethanamine;methyl 4-[(1-adamantylmethylamino)methyl]-3-fluorobenzoate;methyl 4-(bromomethyl)-3-fluorobenzoate (PubChem CID 160859198) has the molecular formula C40H53BrF2N2O4 and a molecular weight of 743.77 g/mol. Its IUPAC name is 1-adamantylmethanamine;methyl 4-[(1-adamantylmethylamino)methyl]-3-fluorobenzoate;methyl 4-(bromomethyl)-3-fluorobenzoate.
| Compound Name | 1-adamantylmethanamine;methyl 4-[(1-adamantylmethylamino)methyl]-3-fluorobenzoate;methyl 4-(bromomethyl)-3-fluorobenzoate |
|---|---|
| PubChem CID | 160859198 |
| Molecular Formula | C40H53BrF2N2O4 |
| Molecular Weight | 743.77 g/mol |
| Exact Mass | 742.32 |
| IUPAC Name | 1-adamantylmethanamine;methyl 4-[(1-adamantylmethylamino)methyl]-3-fluorobenzoate;methyl 4-(bromomethyl)-3-fluorobenzoate |
| SMILES | COC(=O)c1ccc(CBr)c(F)c1.COC(=O)c1ccc(CNCC23CC4CC(CC(C4)C2)C3)c(F)c1.NCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C20H26FNO2.C11H19N.C9H8BrFO2/c1-24-19(23)16-2-3-17(18(21)7-16)11-22-12-20-8-13-4-14(9-20)6-15(5-13)10-20;12-7-11-4-8-1-9(5-11)3-10(2-8)6-11;1-13-9(12)6-2-3-7(5-10)8(11)4-6/h2-3,7,13-15,22H,4-6,8-12H2,1H3;8-10H,1-7,12H2;2-4H,5H2,1H3 |
| InChIKey | SKGKROOGAQJOLR-UHFFFAOYSA-N |
| XLogP | 8.59 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.77 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|