C23H33NO5 — CID 9450030
methyl 4-[(2R)-3-(1-adamantylmethylamino)-2-hydroxypropoxy]-3-methoxybenzoate (PubChem CID 9450030) has the molecular formula C23H33NO5 and a molecular weight of 403.52 g/mol. Its IUPAC name is methyl 4-[(2R)-3-(1-adamantylmethylamino)-2-hydroxypropoxy]-3-methoxybenzoate.
| Compound Name | methyl 4-[(2R)-3-(1-adamantylmethylamino)-2-hydroxypropoxy]-3-methoxybenzoate |
|---|---|
| PubChem CID | 9450030 |
| Molecular Formula | C23H33NO5 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.24 |
| IUPAC Name | methyl 4-[(2R)-3-(1-adamantylmethylamino)-2-hydroxypropoxy]-3-methoxybenzoate |
| SMILES | COC(=O)c1ccc(OC[C@H](O)CNCC23CC4CC(CC(C4)C2)C3)c(OC)c1 |
| InChI | InChI=1S/C23H33NO5/c1-27-21-8-18(22(26)28-2)3-4-20(21)29-13-19(25)12-24-14-23-9-15-5-16(10-23)7-17(6-15)11-23/h3-4,8,15-17,19,24-25H,5-7,9-14H2,1-2H3/t15?,16?,17?,19-,23?/m1/s1 |
| InChIKey | IHUOZBZJRTZWBZ-YLSHDAJPSA-N |
| XLogP | 3.03 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |