C17H25NO6 — CID 8002711
methyl 4-[(2R)-2-hydroxy-3-[[(2S)-oxolan-2-yl]methylamino]propoxy]-3-methoxybenzoate (PubChem CID 8002711) has the molecular formula C17H25NO6 and a molecular weight of 339.39 g/mol. Its IUPAC name is methyl 4-[(2R)-2-hydroxy-3-[[(2S)-oxolan-2-yl]methylamino]propoxy]-3-methoxybenzoate.
| Compound Name | methyl 4-[(2R)-2-hydroxy-3-[[(2S)-oxolan-2-yl]methylamino]propoxy]-3-methoxybenzoate |
|---|---|
| PubChem CID | 8002711 |
| Molecular Formula | C17H25NO6 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | methyl 4-[(2R)-2-hydroxy-3-[[(2S)-oxolan-2-yl]methylamino]propoxy]-3-methoxybenzoate |
| SMILES | COC(=O)c1ccc(OC[C@H](O)CNC[C@@H]2CCCO2)c(OC)c1 |
| InChI | InChI=1S/C17H25NO6/c1-21-16-8-12(17(20)22-2)5-6-15(16)24-11-13(19)9-18-10-14-4-3-7-23-14/h5-6,8,13-14,18-19H,3-4,7,9-11H2,1-2H3/t13-,14+/m1/s1 |
| InChIKey | DMMWTSIUZPDQFP-KGLIPLIRSA-N |
| XLogP | 0.99 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |