C29H38N2O3 — CID 72703342
2-[3-(1-adamantylmethylamino)-2-hydroxypropoxy]-N-(2-phenylethyl)benzamide (PubChem CID 72703342) has the molecular formula C29H38N2O3 and a molecular weight of 462.63 g/mol. Its IUPAC name is 2-[3-(1-adamantylmethylamino)-2-hydroxypropoxy]-N-(2-phenylethyl)benzamide.
| Compound Name | 2-[3-(1-adamantylmethylamino)-2-hydroxypropoxy]-N-(2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 72703342 |
| Molecular Formula | C29H38N2O3 |
| Molecular Weight | 462.63 g/mol |
| Exact Mass | 462.29 |
| IUPAC Name | 2-[3-(1-adamantylmethylamino)-2-hydroxypropoxy]-N-(2-phenylethyl)benzamide |
| SMILES | O=C(NCCc1ccccc1)c1ccccc1OCC(O)CNCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C29H38N2O3/c32-25(18-30-20-29-15-22-12-23(16-29)14-24(13-22)17-29)19-34-27-9-5-4-8-26(27)28(33)31-11-10-21-6-2-1-3-7-21/h1-9,22-25,30,32H,10-20H2,(H,31,33) |
| InChIKey | LKRUOISHXWADEN-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.63 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |