C30H36F3NO3 — CID 140750926
2-[5-(1-adamantyl)-2-hydroxypentoxy]-N-[[4-(trifluoromethyl)phenyl]methyl]benzamide (PubChem CID 140750926) has the molecular formula C30H36F3NO3 and a molecular weight of 515.62 g/mol. Its IUPAC name is 2-[5-(1-adamantyl)-2-hydroxypentoxy]-N-[[4-(trifluoromethyl)phenyl]methyl]benzamide.
| Compound Name | 2-[5-(1-adamantyl)-2-hydroxypentoxy]-N-[[4-(trifluoromethyl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 140750926 |
| Molecular Formula | C30H36F3NO3 |
| Molecular Weight | 515.62 g/mol |
| Exact Mass | 515.26 |
| IUPAC Name | 2-[5-(1-adamantyl)-2-hydroxypentoxy]-N-[[4-(trifluoromethyl)phenyl]methyl]benzamide |
| SMILES | O=C(NCc1ccc(C(F)(F)F)cc1)c1ccccc1OCC(O)CCCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C30H36F3NO3/c31-30(32,33)24-9-7-20(8-10-24)18-34-28(36)26-5-1-2-6-27(26)37-19-25(35)4-3-11-29-15-21-12-22(16-29)14-23(13-21)17-29/h1-2,5-10,21-23,25,35H,3-4,11-19H2,(H,34,36) |
| InChIKey | LTMHZCKHXDVICA-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.62 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |