C28H34FNO3 — CID 140750916
2-[5-(1-adamantyl)-2-hydroxypentoxy]-N-(4-fluorophenyl)benzamide (PubChem CID 140750916) has the molecular formula C28H34FNO3 and a molecular weight of 451.58 g/mol. Its IUPAC name is 2-[5-(1-adamantyl)-2-hydroxypentoxy]-N-(4-fluorophenyl)benzamide.
| Compound Name | 2-[5-(1-adamantyl)-2-hydroxypentoxy]-N-(4-fluorophenyl)benzamide |
|---|---|
| PubChem CID | 140750916 |
| Molecular Formula | C28H34FNO3 |
| Molecular Weight | 451.58 g/mol |
| Exact Mass | 451.25 |
| IUPAC Name | 2-[5-(1-adamantyl)-2-hydroxypentoxy]-N-(4-fluorophenyl)benzamide |
| SMILES | O=C(Nc1ccc(F)cc1)c1ccccc1OCC(O)CCCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C28H34FNO3/c29-22-7-9-23(10-8-22)30-27(32)25-5-1-2-6-26(25)33-18-24(31)4-3-11-28-15-19-12-20(16-28)14-21(13-19)17-28/h1-2,5-10,19-21,24,31H,3-4,11-18H2,(H,30,32) |
| InChIKey | ABEOQBPCGNUSKN-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.58 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |