C30H33FN2O3 — CID 72705337
3-[3-(1-adamantylamino)-2-hydroxypropoxy]-N-(4-fluorophenyl)naphthalene-2-carboxamide (PubChem CID 72705337) has the molecular formula C30H33FN2O3 and a molecular weight of 488.60 g/mol. Its IUPAC name is 3-[3-(1-adamantylamino)-2-hydroxypropoxy]-N-(4-fluorophenyl)naphthalene-2-carboxamide.
| Compound Name | 3-[3-(1-adamantylamino)-2-hydroxypropoxy]-N-(4-fluorophenyl)naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 72705337 |
| Molecular Formula | C30H33FN2O3 |
| Molecular Weight | 488.60 g/mol |
| Exact Mass | 488.25 |
| IUPAC Name | 3-[3-(1-adamantylamino)-2-hydroxypropoxy]-N-(4-fluorophenyl)naphthalene-2-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1)c1cc2ccccc2cc1OCC(O)CNC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C30H33FN2O3/c31-24-5-7-25(8-6-24)33-29(35)27-12-22-3-1-2-4-23(22)13-28(27)36-18-26(34)17-32-30-14-19-9-20(15-30)11-21(10-19)16-30/h1-8,12-13,19-21,26,32,34H,9-11,14-18H2,(H,33,35) |
| InChIKey | SZIJFAPPCJYRCW-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.60 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |