C27H33FN2O3 — CID 72704374
2-[3-(1-adamantylmethylamino)-2-hydroxypropoxy]-N-(4-fluorophenyl)benzamide (PubChem CID 72704374) has the molecular formula C27H33FN2O3 and a molecular weight of 452.57 g/mol. Its IUPAC name is 2-[3-(1-adamantylmethylamino)-2-hydroxypropoxy]-N-(4-fluorophenyl)benzamide.
| Compound Name | 2-[3-(1-adamantylmethylamino)-2-hydroxypropoxy]-N-(4-fluorophenyl)benzamide |
|---|---|
| PubChem CID | 72704374 |
| Molecular Formula | C27H33FN2O3 |
| Molecular Weight | 452.57 g/mol |
| Exact Mass | 452.25 |
| IUPAC Name | 2-[3-(1-adamantylmethylamino)-2-hydroxypropoxy]-N-(4-fluorophenyl)benzamide |
| SMILES | O=C(Nc1ccc(F)cc1)c1ccccc1OCC(O)CNCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C27H33FN2O3/c28-21-5-7-22(8-6-21)30-26(32)24-3-1-2-4-25(24)33-16-23(31)15-29-17-27-12-18-9-19(13-27)11-20(10-18)14-27/h1-8,18-20,23,29,31H,9-17H2,(H,30,32) |
| InChIKey | IKPZYYBLMDGUKD-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.57 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |