C32H31NO4 — CID 140750924
2-[5-(4-benzoylphenyl)-2-hydroxypentoxy]-N-benzylbenzamide (PubChem CID 140750924) has the molecular formula C32H31NO4 and a molecular weight of 493.60 g/mol. Its IUPAC name is 2-[5-(4-benzoylphenyl)-2-hydroxypentoxy]-N-benzylbenzamide.
| Compound Name | 2-[5-(4-benzoylphenyl)-2-hydroxypentoxy]-N-benzylbenzamide |
|---|---|
| PubChem CID | 140750924 |
| Molecular Formula | C32H31NO4 |
| Molecular Weight | 493.60 g/mol |
| Exact Mass | 493.23 |
| IUPAC Name | 2-[5-(4-benzoylphenyl)-2-hydroxypentoxy]-N-benzylbenzamide |
| SMILES | O=C(c1ccccc1)c1ccc(CCCC(O)COc2ccccc2C(=O)NCc2ccccc2)cc1 |
| InChI | InChI=1S/C32H31NO4/c34-28(15-9-12-24-18-20-27(21-19-24)31(35)26-13-5-2-6-14-26)23-37-30-17-8-7-16-29(30)32(36)33-22-25-10-3-1-4-11-25/h1-8,10-11,13-14,16-21,28,34H,9,12,15,22-23H2,(H,33,36) |
| InChIKey | MSVQOECUCZQEKB-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.60 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |