C22H33NO3 — CID 4801616
1-(1-adamantylmethylamino)-3-[(3-methoxyphenyl)methoxy]propan-2-ol (PubChem CID 4801616) has the molecular formula C22H33NO3 and a molecular weight of 359.51 g/mol. Its IUPAC name is 1-(1-adamantylmethylamino)-3-[(3-methoxyphenyl)methoxy]propan-2-ol.
| Compound Name | 1-(1-adamantylmethylamino)-3-[(3-methoxyphenyl)methoxy]propan-2-ol |
|---|---|
| PubChem CID | 4801616 |
| Molecular Formula | C22H33NO3 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.25 |
| IUPAC Name | 1-(1-adamantylmethylamino)-3-[(3-methoxyphenyl)methoxy]propan-2-ol |
| SMILES | COc1cccc(COCC(O)CNCC23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C22H33NO3/c1-25-21-4-2-3-16(8-21)13-26-14-20(24)12-23-15-22-9-17-5-18(10-22)7-19(6-17)11-22/h2-4,8,17-20,23-24H,5-7,9-15H2,1H3 |
| InChIKey | QKKXDSYPHQVYJX-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |