C22H28F3NO — CID 159228203
4-[3-(1-adamantyl)propyl]-N-methyl-3-(trifluoromethyl)benzamide (PubChem CID 159228203) has the molecular formula C22H28F3NO and a molecular weight of 379.47 g/mol. Its IUPAC name is 4-[3-(1-adamantyl)propyl]-N-methyl-3-(trifluoromethyl)benzamide.
| Compound Name | 4-[3-(1-adamantyl)propyl]-N-methyl-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 159228203 |
| Molecular Formula | C22H28F3NO |
| Molecular Weight | 379.47 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | 4-[3-(1-adamantyl)propyl]-N-methyl-3-(trifluoromethyl)benzamide |
| SMILES | CNC(=O)c1ccc(CCCC23CC4CC(CC(C4)C2)C3)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H28F3NO/c1-26-20(27)18-5-4-17(19(10-18)22(23,24)25)3-2-6-21-11-14-7-15(12-21)9-16(8-14)13-21/h4-5,10,14-16H,2-3,6-9,11-13H2,1H3,(H,26,27) |
| InChIKey | XMCMFQLHDXPQRB-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.47 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |