C23H23Cl2FN2O2 — CID 159494667
3-chloro-4-methylaniline;methyl 4-[(3-chloro-4-methylanilino)methyl]-3-fluorobenzoate (PubChem CID 159494667) has the molecular formula C23H23Cl2FN2O2 and a molecular weight of 449.35 g/mol. Its IUPAC name is 3-chloro-4-methylaniline;methyl 4-[(3-chloro-4-methylanilino)methyl]-3-fluorobenzoate.
| Compound Name | 3-chloro-4-methylaniline;methyl 4-[(3-chloro-4-methylanilino)methyl]-3-fluorobenzoate |
|---|---|
| PubChem CID | 159494667 |
| Molecular Formula | C23H23Cl2FN2O2 |
| Molecular Weight | 449.35 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | 3-chloro-4-methylaniline;methyl 4-[(3-chloro-4-methylanilino)methyl]-3-fluorobenzoate |
| SMILES | COC(=O)c1ccc(CNc2ccc(C)c(Cl)c2)c(F)c1.Cc1ccc(N)cc1Cl |
| InChI | InChI=1S/C16H15ClFNO2.C7H8ClN/c1-10-3-6-13(8-14(10)17)19-9-12-5-4-11(7-15(12)18)16(20)21-2;1-5-2-3-6(9)4-7(5)8/h3-8,19H,9H2,1-2H3;2-4H,9H2,1H3 |
| InChIKey | LYQCAHNJJNVOSQ-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.35 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|