About methyl 2-amino-5-[(2,4-difluorophenyl)methylamino]benzoate
methyl 2-amino-5-[(2,4-difluorophenyl)methylamino]benzoate (PubChem CID 62227778) has the molecular formula C15H14F2N2O2
and a molecular weight of 292.29 g/mol. Its IUPAC name is methyl 2-amino-5-[(2,4-difluorophenyl)methylamino]benzoate.
Molecular Properties
| Compound Name | methyl 2-amino-5-[(2,4-difluorophenyl)methylamino]benzoate |
| PubChem CID | 62227778 |
| Molecular Formula | C15H14F2N2O2 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | methyl 2-amino-5-[(2,4-difluorophenyl)methylamino]benzoate |
| SMILES | COC(=O)c1cc(NCc2ccc(F)cc2F)ccc1N |
| InChI | InChI=1S/C15H14F2N2O2/c1-21-15(20)12-7-11(4-5-14(12)18)19-8-9-2-3-10(16)6-13(9)17/h2-7,19H,8,18H2,1H3 |
| InChIKey | RJGDFMMONDHYFA-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-amino-5-[(2,4-difluorophenyl)methylamino]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-amino-5-[(2,4-difluorophenyl)methylamino]benzoate?
The IUPAC name of methyl 2-amino-5-[(2,4-difluorophenyl)methylamino]benzoate (CID 62227778) is methyl 2-amino-5-[(2,4-difluorophenyl)methylamino]benzoate.
What is the SMILES notation for methyl 2-amino-5-[(2,4-difluorophenyl)methylamino]benzoate?
The canonical SMILES for methyl 2-amino-5-[(2,4-difluorophenyl)methylamino]benzoate is COC(=O)c1cc(NCc2ccc(F)cc2F)ccc1N.
What is the InChIKey of methyl 2-amino-5-[(2,4-difluorophenyl)methylamino]benzoate?
The InChIKey is RJGDFMMONDHYFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14F2N2O2/c1-21-15(20)12-7-11(4-5-14(12)18)19-8-9-2-3-10(16)6-13(9)17/h2-7,19H,8,18H2,1H3.
What are the key properties of methyl 2-amino-5-[(2,4-difluorophenyl)methylamino]benzoate?
methyl 2-amino-5-[(2,4-difluorophenyl)methylamino]benzoate has a molecular weight of 292.29 g/mol, XLogP of 2.95, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-amino-5-[(2,4-difluorophenyl)methylamino]benzoate is sourced from PubChem (CID 62227778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).