C15H12F3NO3 — CID 58439731
methyl 2-[(2,4-difluorophenyl)methylamino]-4-fluoro-5-hydroxybenzoate (PubChem CID 58439731) has the molecular formula C15H12F3NO3 and a molecular weight of 311.26 g/mol. Its IUPAC name is methyl 2-[(2,4-difluorophenyl)methylamino]-4-fluoro-5-hydroxybenzoate.
| Compound Name | methyl 2-[(2,4-difluorophenyl)methylamino]-4-fluoro-5-hydroxybenzoate |
|---|---|
| PubChem CID | 58439731 |
| Molecular Formula | C15H12F3NO3 |
| Molecular Weight | 311.26 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | methyl 2-[(2,4-difluorophenyl)methylamino]-4-fluoro-5-hydroxybenzoate |
| SMILES | COC(=O)c1cc(O)c(F)cc1NCc1ccc(F)cc1F |
| InChI | InChI=1S/C15H12F3NO3/c1-22-15(21)10-5-14(20)12(18)6-13(10)19-7-8-2-3-9(16)4-11(8)17/h2-6,19-20H,7H2,1H3 |
| InChIKey | SOCLMXZDXLCBEP-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.26 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|