C17H19FN2O3S — CID 157227251
N-[[4-(2-aminoacetyl)-2-fluorophenyl]methyl]-N-phenylethanesulfonamide (PubChem CID 157227251) has the molecular formula C17H19FN2O3S and a molecular weight of 350.42 g/mol. Its IUPAC name is N-[[4-(2-aminoacetyl)-2-fluorophenyl]methyl]-N-phenylethanesulfonamide.
| Compound Name | N-[[4-(2-aminoacetyl)-2-fluorophenyl]methyl]-N-phenylethanesulfonamide |
|---|---|
| PubChem CID | 157227251 |
| Molecular Formula | C17H19FN2O3S |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | N-[[4-(2-aminoacetyl)-2-fluorophenyl]methyl]-N-phenylethanesulfonamide |
| SMILES | CCS(=O)(=O)N(Cc1ccc(C(=O)CN)cc1F)c1ccccc1 |
| InChI | InChI=1S/C17H19FN2O3S/c1-2-24(22,23)20(15-6-4-3-5-7-15)12-14-9-8-13(10-16(14)18)17(21)11-19/h3-10H,2,11-12,19H2,1H3 |
| InChIKey | LUUPXXUQOSZKLE-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |