C23H32FNO4S — CID 145238433
ethane;methyl 3-fluoro-4-[(N-hexylsulfonylanilino)methyl]benzoate (PubChem CID 145238433) has the molecular formula C23H32FNO4S and a molecular weight of 437.58 g/mol. Its IUPAC name is ethane;methyl 3-fluoro-4-[(N-hexylsulfonylanilino)methyl]benzoate.
| Compound Name | ethane;methyl 3-fluoro-4-[(N-hexylsulfonylanilino)methyl]benzoate |
|---|---|
| PubChem CID | 145238433 |
| Molecular Formula | C23H32FNO4S |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | ethane;methyl 3-fluoro-4-[(N-hexylsulfonylanilino)methyl]benzoate |
| SMILES | CC.CCCCCCS(=O)(=O)N(Cc1ccc(C(=O)OC)cc1F)c1ccccc1 |
| InChI | InChI=1S/C21H26FNO4S.C2H6/c1-3-4-5-9-14-28(25,26)23(19-10-7-6-8-11-19)16-18-13-12-17(15-20(18)22)21(24)27-2;1-2/h6-8,10-13,15H,3-5,9,14,16H2,1-2H3;1-2H3 |
| InChIKey | MVLZZAOLBMPDPH-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|