C16H14F4N4O4S — CID 126508041
N-[[3-fluoro-4-[[(2,2,2-trifluoroacetyl)amino]carbamoyl]phenyl]methyl]-N-pyridin-3-ylmethanesulfonamide (PubChem CID 126508041) has the molecular formula C16H14F4N4O4S and a molecular weight of 434.37 g/mol. Its IUPAC name is N-[[3-fluoro-4-[[(2,2,2-trifluoroacetyl)amino]carbamoyl]phenyl]methyl]-N-pyridin-3-ylmethanesulfonamide.
| Compound Name | N-[[3-fluoro-4-[[(2,2,2-trifluoroacetyl)amino]carbamoyl]phenyl]methyl]-N-pyridin-3-ylmethanesulfonamide |
|---|---|
| PubChem CID | 126508041 |
| Molecular Formula | C16H14F4N4O4S |
| Molecular Weight | 434.37 g/mol |
| Exact Mass | 434.07 |
| IUPAC Name | N-[[3-fluoro-4-[[(2,2,2-trifluoroacetyl)amino]carbamoyl]phenyl]methyl]-N-pyridin-3-ylmethanesulfonamide |
| SMILES | CS(=O)(=O)N(Cc1ccc(C(=O)NNC(=O)C(F)(F)F)c(F)c1)c1cccnc1 |
| InChI | InChI=1S/C16H14F4N4O4S/c1-29(27,28)24(11-3-2-6-21-8-11)9-10-4-5-12(13(17)7-10)14(25)22-23-15(26)16(18,19)20/h2-8H,9H2,1H3,(H,22,25)(H,23,26) |
| InChIKey | ILXOPILOBWAFJA-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.37 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|