C18H17F4N3O3S — CID 145238909
2-fluoro-4-[(N-(methyl-methylidene-oxo-λ6-sulfanyl)anilino)methyl]-N'-(2,2,2-trifluoroacetyl)benzohydrazide (PubChem CID 145238909) has the molecular formula C18H17F4N3O3S and a molecular weight of 431.41 g/mol. Its IUPAC name is 2-fluoro-4-[(N-(methyl-methylidene-oxo-λ6-sulfanyl)anilino)methyl]-N'-(2,2,2-trifluoroacetyl)benzohydrazide.
| Compound Name | 2-fluoro-4-[(N-(methyl-methylidene-oxo-λ6-sulfanyl)anilino)methyl]-N'-(2,2,2-trifluoroacetyl)benzohydrazide |
|---|---|
| PubChem CID | 145238909 |
| Molecular Formula | C18H17F4N3O3S |
| Molecular Weight | 431.41 g/mol |
| Exact Mass | 431.09 |
| IUPAC Name | 2-fluoro-4-[(N-(methyl-methylidene-oxo-λ6-sulfanyl)anilino)methyl]-N'-(2,2,2-trifluoroacetyl)benzohydrazide |
| SMILES | C=S(C)(=O)N(Cc1ccc(C(=O)NNC(=O)C(F)(F)F)c(F)c1)c1ccccc1 |
| InChI | InChI=1S/C18H17F4N3O3S/c1-29(2,28)25(13-6-4-3-5-7-13)11-12-8-9-14(15(19)10-12)16(26)23-24-17(27)18(20,21)22/h3-10H,1,11H2,2H3,(H,23,26)(H,24,27) |
| InChIKey | CEKUYMNCFHQZAK-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.41 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|