C25H24FNO3 — CID 71254804
4-[4-[(3-fluoro-N-pentanoylanilino)methyl]phenyl]benzoic acid (PubChem CID 71254804) has the molecular formula C25H24FNO3 and a molecular weight of 405.47 g/mol. Its IUPAC name is 4-[4-[(3-fluoro-N-pentanoylanilino)methyl]phenyl]benzoic acid.
| Compound Name | 4-[4-[(3-fluoro-N-pentanoylanilino)methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 71254804 |
| Molecular Formula | C25H24FNO3 |
| Molecular Weight | 405.47 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | 4-[4-[(3-fluoro-N-pentanoylanilino)methyl]phenyl]benzoic acid |
| SMILES | CCCCC(=O)N(Cc1ccc(-c2ccc(C(=O)O)cc2)cc1)c1cccc(F)c1 |
| InChI | InChI=1S/C25H24FNO3/c1-2-3-7-24(28)27(23-6-4-5-22(26)16-23)17-18-8-10-19(11-9-18)20-12-14-21(15-13-20)25(29)30/h4-6,8-16H,2-3,7,17H2,1H3,(H,29,30) |
| InChIKey | ULIQIXSXQQBMIA-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.47 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |