C50H50N2O6 — CID 159323400
2-[4-[(N-pentanoylanilino)methyl]phenyl]benzoic acid (PubChem CID 159323400) has the molecular formula C50H50N2O6 and a molecular weight of 774.96 g/mol. Its IUPAC name is 2-[4-[(N-pentanoylanilino)methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[(N-pentanoylanilino)methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 159323400 |
| Molecular Formula | C50H50N2O6 |
| Molecular Weight | 774.96 g/mol |
| Exact Mass | 774.37 |
| IUPAC Name | 2-[4-[(N-pentanoylanilino)methyl]phenyl]benzoic acid |
| SMILES | CCCCC(=O)N(Cc1ccc(-c2ccccc2C(=O)O)cc1)c1ccccc1.CCCCC(=O)N(Cc1ccc(-c2ccccc2C(=O)O)cc1)c1ccccc1 |
| InChI | InChI=1S/2C25H25NO3/c2*1-2-3-13-24(27)26(21-9-5-4-6-10-21)18-19-14-16-20(17-15-19)22-11-7-8-12-23(22)25(28)29/h2*4-12,14-17H,2-3,13,18H2,1H3,(H,28,29) |
| InChIKey | LEAZGRQFGUJATE-UHFFFAOYSA-N |
| XLogP | 11.55 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.96 |
| LogP ≤ 5 | 11.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |