C24H23NO3 — CID 162647867
2-[4-[[N-(2-methylpropanoyl)anilino]methyl]phenyl]benzoic acid (PubChem CID 162647867) has the molecular formula C24H23NO3 and a molecular weight of 373.45 g/mol. Its IUPAC name is 2-[4-[[N-(2-methylpropanoyl)anilino]methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[[N-(2-methylpropanoyl)anilino]methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 162647867 |
| Molecular Formula | C24H23NO3 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | 2-[4-[[N-(2-methylpropanoyl)anilino]methyl]phenyl]benzoic acid |
| SMILES | CC(C)C(=O)N(Cc1ccc(-c2ccccc2C(=O)O)cc1)c1ccccc1 |
| InChI | InChI=1S/C24H23NO3/c1-17(2)23(26)25(20-8-4-3-5-9-20)16-18-12-14-19(15-13-18)21-10-6-7-11-22(21)24(27)28/h3-15,17H,16H2,1-2H3,(H,27,28) |
| InChIKey | KMPUPVNGHDHCFQ-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |