C25H23FN2O2 — CID 46046401
N-[(4-fluorophenyl)methyl]-N-[4-[2-oxo-2-(prop-2-enylamino)ethyl]phenyl]benzamide (PubChem CID 46046401) has the molecular formula C25H23FN2O2 and a molecular weight of 402.47 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-N-[4-[2-oxo-2-(prop-2-enylamino)ethyl]phenyl]benzamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-N-[4-[2-oxo-2-(prop-2-enylamino)ethyl]phenyl]benzamide |
|---|---|
| PubChem CID | 46046401 |
| Molecular Formula | C25H23FN2O2 |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-N-[4-[2-oxo-2-(prop-2-enylamino)ethyl]phenyl]benzamide |
| SMILES | C=CCNC(=O)Cc1ccc(N(Cc2ccc(F)cc2)C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H23FN2O2/c1-2-16-27-24(29)17-19-10-14-23(15-11-19)28(18-20-8-12-22(26)13-9-20)25(30)21-6-4-3-5-7-21/h2-15H,1,16-18H2,(H,27,29) |
| InChIKey | RQUQXZBCFXZIRX-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|