C23H21FN2O2S — CID 46046522
N-[(3-fluorophenyl)methyl]-N-[4-[2-oxo-2-(prop-2-enylamino)ethyl]phenyl]thiophene-2-carboxamide (PubChem CID 46046522) has the molecular formula C23H21FN2O2S and a molecular weight of 408.50 g/mol. Its IUPAC name is N-[(3-fluorophenyl)methyl]-N-[4-[2-oxo-2-(prop-2-enylamino)ethyl]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[(3-fluorophenyl)methyl]-N-[4-[2-oxo-2-(prop-2-enylamino)ethyl]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 46046522 |
| Molecular Formula | C23H21FN2O2S |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | N-[(3-fluorophenyl)methyl]-N-[4-[2-oxo-2-(prop-2-enylamino)ethyl]phenyl]thiophene-2-carboxamide |
| SMILES | C=CCNC(=O)Cc1ccc(N(Cc2cccc(F)c2)C(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C23H21FN2O2S/c1-2-12-25-22(27)15-17-8-10-20(11-9-17)26(23(28)21-7-4-13-29-21)16-18-5-3-6-19(24)14-18/h2-11,13-14H,1,12,15-16H2,(H,25,27) |
| InChIKey | HOBWCSJUONZDAX-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|