C21H22F2N4O4 — CID 140894353
N-[[4-[[(2,2-difluoroacetyl)amino]carbamoyl]phenyl]methyl]-N-phenylmorpholine-4-carboxamide (PubChem CID 140894353) has the molecular formula C21H22F2N4O4 and a molecular weight of 432.43 g/mol. Its IUPAC name is N-[[4-[[(2,2-difluoroacetyl)amino]carbamoyl]phenyl]methyl]-N-phenylmorpholine-4-carboxamide.
| Compound Name | N-[[4-[[(2,2-difluoroacetyl)amino]carbamoyl]phenyl]methyl]-N-phenylmorpholine-4-carboxamide |
|---|---|
| PubChem CID | 140894353 |
| Molecular Formula | C21H22F2N4O4 |
| Molecular Weight | 432.43 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | N-[[4-[[(2,2-difluoroacetyl)amino]carbamoyl]phenyl]methyl]-N-phenylmorpholine-4-carboxamide |
| SMILES | O=C(NNC(=O)C(F)F)c1ccc(CN(C(=O)N2CCOCC2)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H22F2N4O4/c22-18(23)20(29)25-24-19(28)16-8-6-15(7-9-16)14-27(17-4-2-1-3-5-17)21(30)26-10-12-31-13-11-26/h1-9,18H,10-14H2,(H,24,28)(H,25,29) |
| InChIKey | XOUQIADZLLIUNE-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.43 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|