C22H24F2N4O3S — CID 134584917
N-[[4-[[(2,2-difluoroacetyl)amino]carbamoyl]phenyl]methyl]-N-(4-methylphenyl)thiomorpholine-4-carboxamide (PubChem CID 134584917) has the molecular formula C22H24F2N4O3S and a molecular weight of 462.52 g/mol. Its IUPAC name is N-[[4-[[(2,2-difluoroacetyl)amino]carbamoyl]phenyl]methyl]-N-(4-methylphenyl)thiomorpholine-4-carboxamide.
| Compound Name | N-[[4-[[(2,2-difluoroacetyl)amino]carbamoyl]phenyl]methyl]-N-(4-methylphenyl)thiomorpholine-4-carboxamide |
|---|---|
| PubChem CID | 134584917 |
| Molecular Formula | C22H24F2N4O3S |
| Molecular Weight | 462.52 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | N-[[4-[[(2,2-difluoroacetyl)amino]carbamoyl]phenyl]methyl]-N-(4-methylphenyl)thiomorpholine-4-carboxamide |
| SMILES | Cc1ccc(N(Cc2ccc(C(=O)NNC(=O)C(F)F)cc2)C(=O)N2CCSCC2)cc1 |
| InChI | InChI=1S/C22H24F2N4O3S/c1-15-2-8-18(9-3-15)28(22(31)27-10-12-32-13-11-27)14-16-4-6-17(7-5-16)20(29)25-26-21(30)19(23)24/h2-9,19H,10-14H2,1H3,(H,25,29)(H,26,30) |
| InChIKey | FRNBYCVSOSTCNR-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.52 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|