C21H22F3N5O4 — CID 134584599
N-[[5-[[(2,2-difluoroacetyl)amino]carbamoyl]-2-pyridinyl]methyl]-N-(2-fluoro-4-methylphenyl)morpholine-4-carboxamide (PubChem CID 134584599) has the molecular formula C21H22F3N5O4 and a molecular weight of 465.43 g/mol. Its IUPAC name is N-[[5-[[(2,2-difluoroacetyl)amino]carbamoyl]-2-pyridinyl]methyl]-N-(2-fluoro-4-methylphenyl)morpholine-4-carboxamide.
| Compound Name | N-[[5-[[(2,2-difluoroacetyl)amino]carbamoyl]-2-pyridinyl]methyl]-N-(2-fluoro-4-methylphenyl)morpholine-4-carboxamide |
|---|---|
| PubChem CID | 134584599 |
| Molecular Formula | C21H22F3N5O4 |
| Molecular Weight | 465.43 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | N-[[5-[[(2,2-difluoroacetyl)amino]carbamoyl]-2-pyridinyl]methyl]-N-(2-fluoro-4-methylphenyl)morpholine-4-carboxamide |
| SMILES | Cc1ccc(N(Cc2ccc(C(=O)NNC(=O)C(F)F)cn2)C(=O)N2CCOCC2)c(F)c1 |
| InChI | InChI=1S/C21H22F3N5O4/c1-13-2-5-17(16(22)10-13)29(21(32)28-6-8-33-9-7-28)12-15-4-3-14(11-25-15)19(30)26-27-20(31)18(23)24/h2-5,10-11,18H,6-9,12H2,1H3,(H,26,30)(H,27,31) |
| InChIKey | XQSPEJGNSICEPN-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 103.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.43 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|