C26H33F3N4O4 — CID 134584700
N-(1-adamantylmethyl)-N-[[4-[[(2,2-difluoroacetyl)amino]carbamoyl]-2-fluorophenyl]methyl]morpholine-4-carboxamide (PubChem CID 134584700) has the molecular formula C26H33F3N4O4 and a molecular weight of 522.57 g/mol. Its IUPAC name is N-(1-adamantylmethyl)-N-[[4-[[(2,2-difluoroacetyl)amino]carbamoyl]-2-fluorophenyl]methyl]morpholine-4-carboxamide.
| Compound Name | N-(1-adamantylmethyl)-N-[[4-[[(2,2-difluoroacetyl)amino]carbamoyl]-2-fluorophenyl]methyl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 134584700 |
| Molecular Formula | C26H33F3N4O4 |
| Molecular Weight | 522.57 g/mol |
| Exact Mass | 522.25 |
| IUPAC Name | N-(1-adamantylmethyl)-N-[[4-[[(2,2-difluoroacetyl)amino]carbamoyl]-2-fluorophenyl]methyl]morpholine-4-carboxamide |
| SMILES | O=C(NNC(=O)C(F)F)c1ccc(CN(CC23CC4CC(CC(C4)C2)C3)C(=O)N2CCOCC2)c(F)c1 |
| InChI | InChI=1S/C26H33F3N4O4/c27-21-10-19(23(34)30-31-24(35)22(28)29)1-2-20(21)14-33(25(36)32-3-5-37-6-4-32)15-26-11-16-7-17(12-26)9-18(8-16)13-26/h1-2,10,16-18,22H,3-9,11-15H2,(H,30,34)(H,31,35) |
| InChIKey | WYMQCFZGPKVQHF-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.57 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|