C23H29FN2O4 — CID 134584285
4-[[1-adamantyl(morpholine-4-carbonyl)amino]methyl]-3-fluorobenzoic acid (PubChem CID 134584285) has the molecular formula C23H29FN2O4 and a molecular weight of 416.49 g/mol. Its IUPAC name is 4-[[1-adamantyl(morpholine-4-carbonyl)amino]methyl]-3-fluorobenzoic acid.
| Compound Name | 4-[[1-adamantyl(morpholine-4-carbonyl)amino]methyl]-3-fluorobenzoic acid |
|---|---|
| PubChem CID | 134584285 |
| Molecular Formula | C23H29FN2O4 |
| Molecular Weight | 416.49 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | 4-[[1-adamantyl(morpholine-4-carbonyl)amino]methyl]-3-fluorobenzoic acid |
| SMILES | O=C(O)c1ccc(CN(C(=O)N2CCOCC2)C23CC4CC(CC(C4)C2)C3)c(F)c1 |
| InChI | InChI=1S/C23H29FN2O4/c24-20-10-18(21(27)28)1-2-19(20)14-26(22(29)25-3-5-30-6-4-25)23-11-15-7-16(12-23)9-17(8-15)13-23/h1-2,10,15-17H,3-9,11-14H2,(H,27,28) |
| InChIKey | BKHGQNJHMSYPAC-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.49 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |