C39H39F4N5O8 — CID 175784678
N-(2,4-difluorophenyl)-N-[[4-(hydroxycarbamoyl)phenyl]methyl]morpholine-4-carboxamide;methyl 4-[[2,4-difluoro-N-(morpholine-4-carbonyl)anilino]methyl]benzoate (PubChem CID 175784678) has the molecular formula C39H39F4N5O8 and a molecular weight of 781.76 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-N-[[4-(hydroxycarbamoyl)phenyl]methyl]morpholine-4-carboxamide;methyl 4-[[2,4-difluoro-N-(morpholine-4-carbonyl)anilino]methyl]benzoate.
| Compound Name | N-(2,4-difluorophenyl)-N-[[4-(hydroxycarbamoyl)phenyl]methyl]morpholine-4-carboxamide;methyl 4-[[2,4-difluoro-N-(morpholine-4-carbonyl)anilino]methyl]benzoate |
|---|---|
| PubChem CID | 175784678 |
| Molecular Formula | C39H39F4N5O8 |
| Molecular Weight | 781.76 g/mol |
| Exact Mass | 781.27 |
| IUPAC Name | N-(2,4-difluorophenyl)-N-[[4-(hydroxycarbamoyl)phenyl]methyl]morpholine-4-carboxamide;methyl 4-[[2,4-difluoro-N-(morpholine-4-carbonyl)anilino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CN(C(=O)N2CCOCC2)c2ccc(F)cc2F)cc1.O=C(NO)c1ccc(CN(C(=O)N2CCOCC2)c2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C20H20F2N2O4.C19H19F2N3O4/c1-27-19(25)15-4-2-14(3-5-15)13-24(18-7-6-16(21)12-17(18)22)20(26)23-8-10-28-11-9-23;20-15-5-6-17(16(21)11-15)24(19(26)23-7-9-28-10-8-23)12-13-1-3-14(4-2-13)18(25)22-27/h2-7,12H,8-11,13H2,1H3;1-6,11,27H,7-10,12H2,(H,22,25) |
| InChIKey | XMMYFGLDHTWHGZ-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 141.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.76 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|