C26H24F3N5O4S — CID 167496957
1,1-dioxo-N-(4-pyridin-3-ylphenyl)-N-[[4-[5-(trifluoromethyl)-2,3-dihydro-1,3,4-oxadiazol-2-yl]phenyl]methyl]-1,4-thiazinane-4-carboxamide (PubChem CID 167496957) has the molecular formula C26H24F3N5O4S and a molecular weight of 559.57 g/mol. Its IUPAC name is 1,1-dioxo-N-(4-pyridin-3-ylphenyl)-N-[[4-[5-(trifluoromethyl)-2,3-dihydro-1,3,4-oxadiazol-2-yl]phenyl]methyl]-1,4-thiazinane-4-carboxamide.
| Compound Name | 1,1-dioxo-N-(4-pyridin-3-ylphenyl)-N-[[4-[5-(trifluoromethyl)-2,3-dihydro-1,3,4-oxadiazol-2-yl]phenyl]methyl]-1,4-thiazinane-4-carboxamide |
|---|---|
| PubChem CID | 167496957 |
| Molecular Formula | C26H24F3N5O4S |
| Molecular Weight | 559.57 g/mol |
| Exact Mass | 559.15 |
| IUPAC Name | 1,1-dioxo-N-(4-pyridin-3-ylphenyl)-N-[[4-[5-(trifluoromethyl)-2,3-dihydro-1,3,4-oxadiazol-2-yl]phenyl]methyl]-1,4-thiazinane-4-carboxamide |
| SMILES | O=C(N1CCS(=O)(=O)CC1)N(Cc1ccc(C2NN=C(C(F)(F)F)O2)cc1)c1ccc(-c2cccnc2)cc1 |
| InChI | InChI=1S/C26H24F3N5O4S/c27-26(28,29)24-32-31-23(38-24)20-5-3-18(4-6-20)17-34(25(35)33-12-14-39(36,37)15-13-33)22-9-7-19(8-10-22)21-2-1-11-30-16-21/h1-11,16,23,31H,12-15,17H2 |
| InChIKey | YQCKHSQOHKZUDX-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 104.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.57 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |