C18H16F3N3O3 — CID 88757956
N-hydroxy-4-[N-(2-oxopyrrolidin-3-yl)-3-(trifluoromethyl)anilino]benzamide (PubChem CID 88757956) has the molecular formula C18H16F3N3O3 and a molecular weight of 379.34 g/mol. Its IUPAC name is N-hydroxy-4-[N-(2-oxopyrrolidin-3-yl)-3-(trifluoromethyl)anilino]benzamide.
| Compound Name | N-hydroxy-4-[N-(2-oxopyrrolidin-3-yl)-3-(trifluoromethyl)anilino]benzamide |
|---|---|
| PubChem CID | 88757956 |
| Molecular Formula | C18H16F3N3O3 |
| Molecular Weight | 379.34 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | N-hydroxy-4-[N-(2-oxopyrrolidin-3-yl)-3-(trifluoromethyl)anilino]benzamide |
| SMILES | O=C(NO)c1ccc(N(c2cccc(C(F)(F)F)c2)C2CCNC2=O)cc1 |
| InChI | InChI=1S/C18H16F3N3O3/c19-18(20,21)12-2-1-3-14(10-12)24(15-8-9-22-17(15)26)13-6-4-11(5-7-13)16(25)23-27/h1-7,10,15,27H,8-9H2,(H,22,26)(H,23,25) |
| InChIKey | PATPQSBBWCFJPY-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.34 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|