C14H16F3N3O2 — CID 122569454
1-methyl-3-(2-oxopyrrolidin-3-yl)-1-[[3-(trifluoromethyl)phenyl]methyl]urea (PubChem CID 122569454) has the molecular formula C14H16F3N3O2 and a molecular weight of 315.30 g/mol. Its IUPAC name is 1-methyl-3-(2-oxopyrrolidin-3-yl)-1-[[3-(trifluoromethyl)phenyl]methyl]urea.
| Compound Name | 1-methyl-3-(2-oxopyrrolidin-3-yl)-1-[[3-(trifluoromethyl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 122569454 |
| Molecular Formula | C14H16F3N3O2 |
| Molecular Weight | 315.30 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | 1-methyl-3-(2-oxopyrrolidin-3-yl)-1-[[3-(trifluoromethyl)phenyl]methyl]urea |
| SMILES | CN(Cc1cccc(C(F)(F)F)c1)C(=O)NC1CCNC1=O |
| InChI | InChI=1S/C14H16F3N3O2/c1-20(13(22)19-11-5-6-18-12(11)21)8-9-3-2-4-10(7-9)14(15,16)17/h2-4,7,11H,5-6,8H2,1H3,(H,18,21)(H,19,22) |
| InChIKey | HGTYISOXIFZOBJ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.30 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |