C15H17F3N2O2 — CID 146122046
(2R)-N-methyl-6-oxo-N-[[3-(trifluoromethyl)phenyl]methyl]piperidine-2-carboxamide (PubChem CID 146122046) has the molecular formula C15H17F3N2O2 and a molecular weight of 314.31 g/mol. Its IUPAC name is (2R)-N-methyl-6-oxo-N-[[3-(trifluoromethyl)phenyl]methyl]piperidine-2-carboxamide.
| Compound Name | (2R)-N-methyl-6-oxo-N-[[3-(trifluoromethyl)phenyl]methyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 146122046 |
| Molecular Formula | C15H17F3N2O2 |
| Molecular Weight | 314.31 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | (2R)-N-methyl-6-oxo-N-[[3-(trifluoromethyl)phenyl]methyl]piperidine-2-carboxamide |
| SMILES | CN(Cc1cccc(C(F)(F)F)c1)C(=O)[C@H]1CCCC(=O)N1 |
| InChI | InChI=1S/C15H17F3N2O2/c1-20(14(22)12-6-3-7-13(21)19-12)9-10-4-2-5-11(8-10)15(16,17)18/h2,4-5,8,12H,3,6-7,9H2,1H3,(H,19,21)/t12-/m1/s1 |
| InChIKey | CAHBTMKJFOQRQG-GFCCVEGCSA-N |
| XLogP | 2.33 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.31 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |