C24H20F3N3O3 — CID 73300939
N-hydroxy-4-[[3-oxo-2-[[3-(trifluoromethyl)phenyl]methyl]-2,4-dihydroquinoxalin-1-yl]methyl]benzamide (PubChem CID 73300939) has the molecular formula C24H20F3N3O3 and a molecular weight of 455.44 g/mol. Its IUPAC name is N-hydroxy-4-[[3-oxo-2-[[3-(trifluoromethyl)phenyl]methyl]-2,4-dihydroquinoxalin-1-yl]methyl]benzamide.
| Compound Name | N-hydroxy-4-[[3-oxo-2-[[3-(trifluoromethyl)phenyl]methyl]-2,4-dihydroquinoxalin-1-yl]methyl]benzamide |
|---|---|
| PubChem CID | 73300939 |
| Molecular Formula | C24H20F3N3O3 |
| Molecular Weight | 455.44 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | N-hydroxy-4-[[3-oxo-2-[[3-(trifluoromethyl)phenyl]methyl]-2,4-dihydroquinoxalin-1-yl]methyl]benzamide |
| SMILES | O=C(NO)c1ccc(CN2c3ccccc3NC(=O)C2Cc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C24H20F3N3O3/c25-24(26,27)18-5-3-4-16(12-18)13-21-23(32)28-19-6-1-2-7-20(19)30(21)14-15-8-10-17(11-9-15)22(31)29-33/h1-12,21,33H,13-14H2,(H,28,32)(H,29,31) |
| InChIKey | WAIMOLOXMDNIKY-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.44 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|