C18H16N4O3 — CID 88757091
4-(4-cyano-N-(2-oxopyrrolidin-3-yl)anilino)-N-hydroxybenzamide (PubChem CID 88757091) has the molecular formula C18H16N4O3 and a molecular weight of 336.35 g/mol. Its IUPAC name is 4-(4-cyano-N-(2-oxopyrrolidin-3-yl)anilino)-N-hydroxybenzamide.
| Compound Name | 4-(4-cyano-N-(2-oxopyrrolidin-3-yl)anilino)-N-hydroxybenzamide |
|---|---|
| PubChem CID | 88757091 |
| Molecular Formula | C18H16N4O3 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | 4-(4-cyano-N-(2-oxopyrrolidin-3-yl)anilino)-N-hydroxybenzamide |
| SMILES | N#Cc1ccc(N(c2ccc(C(=O)NO)cc2)C2CCNC2=O)cc1 |
| InChI | InChI=1S/C18H16N4O3/c19-11-12-1-5-14(6-2-12)22(16-9-10-20-18(16)24)15-7-3-13(4-8-15)17(23)21-25/h1-8,16,25H,9-10H2,(H,20,24)(H,21,23) |
| InChIKey | FHTONPSNAPVMFX-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 105.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|